C27H22F2O4 — CID 58203209
(4-ethynyl-3-fluorophenyl) 2-fluoro-4-(4-pentylbenzoyl)oxybenzoate (PubChem CID 58203209) has the molecular formula C27H22F2O4 and a molecular weight of 448.47 g/mol. Its IUPAC name is (4-ethynyl-3-fluorophenyl) 2-fluoro-4-(4-pentylbenzoyl)oxybenzoate.
| Compound Name | (4-ethynyl-3-fluorophenyl) 2-fluoro-4-(4-pentylbenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 58203209 |
| Molecular Formula | C27H22F2O4 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (4-ethynyl-3-fluorophenyl) 2-fluoro-4-(4-pentylbenzoyl)oxybenzoate |
| SMILES | C#Cc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(CCCCC)cc3)cc2F)cc1F |
| InChI | InChI=1S/C27H22F2O4/c1-3-5-6-7-18-8-10-20(11-9-18)26(30)32-22-14-15-23(25(29)17-22)27(31)33-21-13-12-19(4-2)24(28)16-21/h2,8-17H,3,5-7H2,1H3 |
| InChIKey | QJXWKEAZRBNQJL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|