C71H96F2N4O4 — CID 158660178
[3-fluoro-4-(5-nonylpyrimidin-2-yl)phenyl] 4-decylbenzoate;[3-fluoro-4-(5-octylpyrimidin-2-yl)phenyl] 4-decylbenzoate (PubChem CID 158660178) has the molecular formula C71H96F2N4O4 and a molecular weight of 1107.57 g/mol. Its IUPAC name is [3-fluoro-4-(5-nonylpyrimidin-2-yl)phenyl] 4-decylbenzoate;[3-fluoro-4-(5-octylpyrimidin-2-yl)phenyl] 4-decylbenzoate.
| Compound Name | [3-fluoro-4-(5-nonylpyrimidin-2-yl)phenyl] 4-decylbenzoate;[3-fluoro-4-(5-octylpyrimidin-2-yl)phenyl] 4-decylbenzoate |
|---|---|
| PubChem CID | 158660178 |
| Molecular Formula | C71H96F2N4O4 |
| Molecular Weight | 1107.57 g/mol |
| Exact Mass | 1106.74 |
| IUPAC Name | [3-fluoro-4-(5-nonylpyrimidin-2-yl)phenyl] 4-decylbenzoate;[3-fluoro-4-(5-octylpyrimidin-2-yl)phenyl] 4-decylbenzoate |
| SMILES | CCCCCCCCCCc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCCCCC)cn3)c(F)c2)cc1.CCCCCCCCCCc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCCCCCC)cn3)c(F)c2)cc1 |
| InChI | InChI=1S/C36H49FN2O2.C35H47FN2O2/c1-3-5-7-9-11-13-14-16-18-29-20-22-31(23-21-29)36(40)41-32-24-25-33(34(37)26-32)35-38-27-30(28-39-35)19-17-15-12-10-8-6-4-2;1-3-5-7-9-11-12-14-15-17-28-19-21-30(22-20-28)35(39)40-31-23-24-32(33(36)25-31)34-37-26-29(27-38-34)18-16-13-10-8-6-4-2/h20-28H,3-19H2,1-2H3;19-27H,3-18H2,1-2H3 |
| InChIKey | ICQQSYGOSQCQHU-UHFFFAOYSA-N |
| XLogP | 20.57 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.57 |
| LogP ≤ 5 | 20.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|