About [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate
[3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate (PubChem CID 21246992) has the molecular formula C33H43FN2O2
and a molecular weight of 518.72 g/mol. Its IUPAC name is [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate.
Molecular Properties
| Compound Name | [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate |
| PubChem CID | 21246992 |
| Molecular Formula | C33H43FN2O2 |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate |
| SMILES | CCCCCCCCCCc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCCC)cn3)c(F)c2)cc1 |
| InChI | InChI=1S/C33H43FN2O2/c1-3-5-7-9-10-11-12-14-15-26-17-19-28(20-18-26)33(37)38-29-21-22-30(31(34)23-29)32-35-24-27(25-36-32)16-13-8-6-4-2/h17-25H,3-16H2,1-2H3 |
| InChIKey | JRQQIBQDLVZYJE-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate?
The IUPAC name of [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate (CID 21246992) is [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate.
What is the SMILES notation for [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate?
The canonical SMILES for [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate is CCCCCCCCCCc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCCC)cn3)c(F)c2)cc1.
What is the InChIKey of [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate?
The InChIKey is JRQQIBQDLVZYJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H43FN2O2/c1-3-5-7-9-10-11-12-14-15-26-17-19-28(20-18-26)33(37)38-29-21-22-30(31(34)23-29)32-35-24-27(25-36-32)16-13-8-6-4-2/h17-25H,3-16H2,1-2H3.
What are the key properties of [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate?
[3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate has a molecular weight of 518.72 g/mol, XLogP of 9.31, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(5-hexylpyrimidin-2-yl)phenyl] 4-decylbenzoate is sourced from PubChem (CID 21246992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).