C35H49ClO7Si3 — CID 59428917
(4-pentylphenyl) 2-chloro-4-[4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]benzoyl]oxybenzoate (PubChem CID 59428917) has the molecular formula C35H49ClO7Si3 and a molecular weight of 701.48 g/mol. Its IUPAC name is (4-pentylphenyl) 2-chloro-4-[4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]benzoyl]oxybenzoate.
| Compound Name | (4-pentylphenyl) 2-chloro-4-[4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 59428917 |
| Molecular Formula | C35H49ClO7Si3 |
| Molecular Weight | 701.48 g/mol |
| Exact Mass | 700.25 |
| IUPAC Name | (4-pentylphenyl) 2-chloro-4-[4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]benzoyl]oxybenzoate |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)cc3)cc2Cl)cc1 |
| InChI | InChI=1S/C35H49ClO7Si3/c1-9-10-11-13-27-14-18-30(19-15-27)40-35(38)32-23-22-31(26-33(32)36)41-34(37)28-16-20-29(21-17-28)39-24-12-25-46(8,42-44(2,3)4)43-45(5,6)7/h14-23,26H,9-13,24-25H2,1-8H3 |
| InChIKey | GAEQAXFZZBZWRW-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.48 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|