C37H49ClFNO7Si3 — CID 59428900
(4-cyano-2-fluorophenyl) 2-chloro-4-[4-[9-[methyl-bis(trimethylsilyloxy)silyl]nonoxy]benzoyl]oxybenzoate (PubChem CID 59428900) has the molecular formula C37H49ClFNO7Si3 and a molecular weight of 758.51 g/mol. Its IUPAC name is (4-cyano-2-fluorophenyl) 2-chloro-4-[4-[9-[methyl-bis(trimethylsilyloxy)silyl]nonoxy]benzoyl]oxybenzoate.
| Compound Name | (4-cyano-2-fluorophenyl) 2-chloro-4-[4-[9-[methyl-bis(trimethylsilyloxy)silyl]nonoxy]benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 59428900 |
| Molecular Formula | C37H49ClFNO7Si3 |
| Molecular Weight | 758.51 g/mol |
| Exact Mass | 757.25 |
| IUPAC Name | (4-cyano-2-fluorophenyl) 2-chloro-4-[4-[9-[methyl-bis(trimethylsilyloxy)silyl]nonoxy]benzoyl]oxybenzoate |
| SMILES | C[Si](C)(C)O[Si](C)(CCCCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(C#N)cc3F)c(Cl)c2)cc1)O[Si](C)(C)C |
| InChI | InChI=1S/C37H49ClFNO7Si3/c1-48(2,3)46-50(7,47-49(4,5)6)24-14-12-10-8-9-11-13-23-43-30-18-16-29(17-19-30)36(41)44-31-20-21-32(33(38)26-31)37(42)45-35-22-15-28(27-40)25-34(35)39/h15-22,25-26H,8-14,23-24H2,1-7H3 |
| InChIKey | LCUHGGJEONOUPB-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 104.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.51 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|