C25H33FO4 — CID 54470472
(3-fluoro-4-hexoxyphenyl) 4-hexoxybenzoate (PubChem CID 54470472) has the molecular formula C25H33FO4 and a molecular weight of 416.53 g/mol. Its IUPAC name is (3-fluoro-4-hexoxyphenyl) 4-hexoxybenzoate.
| Compound Name | (3-fluoro-4-hexoxyphenyl) 4-hexoxybenzoate |
|---|---|
| PubChem CID | 54470472 |
| Molecular Formula | C25H33FO4 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (3-fluoro-4-hexoxyphenyl) 4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCCC)c(F)c2)cc1 |
| InChI | InChI=1S/C25H33FO4/c1-3-5-7-9-17-28-21-13-11-20(12-14-21)25(27)30-22-15-16-24(23(26)19-22)29-18-10-8-6-4-2/h11-16,19H,3-10,17-18H2,1-2H3 |
| InChIKey | XHZMBRZPNQRBQK-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|