C28H39FO4 — CID 23220712
(4-heptoxyphenyl) 3-fluoro-4-octoxybenzoate (PubChem CID 23220712) has the molecular formula C28H39FO4 and a molecular weight of 458.61 g/mol. Its IUPAC name is (4-heptoxyphenyl) 3-fluoro-4-octoxybenzoate.
| Compound Name | (4-heptoxyphenyl) 3-fluoro-4-octoxybenzoate |
|---|---|
| PubChem CID | 23220712 |
| Molecular Formula | C28H39FO4 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | (4-heptoxyphenyl) 3-fluoro-4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCCCC)cc2)cc1F |
| InChI | InChI=1S/C28H39FO4/c1-3-5-7-9-11-13-21-32-27-19-14-23(22-26(27)29)28(30)33-25-17-15-24(16-18-25)31-20-12-10-8-6-4-2/h14-19,22H,3-13,20-21H2,1-2H3 |
| InChIKey | RGQIPBQZTSQXCI-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|