C22H27FO3 — CID 71386435
(4-butylphenyl) 3-fluoro-4-pentoxybenzoate (PubChem CID 71386435) has the molecular formula C22H27FO3 and a molecular weight of 358.45 g/mol. Its IUPAC name is (4-butylphenyl) 3-fluoro-4-pentoxybenzoate.
| Compound Name | (4-butylphenyl) 3-fluoro-4-pentoxybenzoate |
|---|---|
| PubChem CID | 71386435 |
| Molecular Formula | C22H27FO3 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (4-butylphenyl) 3-fluoro-4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(CCCC)cc2)cc1F |
| InChI | InChI=1S/C22H27FO3/c1-3-5-7-15-25-21-14-11-18(16-20(21)23)22(24)26-19-12-9-17(10-13-19)8-6-4-2/h9-14,16H,3-8,15H2,1-2H3 |
| InChIKey | PUYPIRLVNKFOEK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|