C19H21FO3 — CID 71386436
(4-methylphenyl) 3-fluoro-4-pentoxybenzoate (PubChem CID 71386436) has the molecular formula C19H21FO3 and a molecular weight of 316.37 g/mol. Its IUPAC name is (4-methylphenyl) 3-fluoro-4-pentoxybenzoate.
| Compound Name | (4-methylphenyl) 3-fluoro-4-pentoxybenzoate |
|---|---|
| PubChem CID | 71386436 |
| Molecular Formula | C19H21FO3 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (4-methylphenyl) 3-fluoro-4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(C)cc2)cc1F |
| InChI | InChI=1S/C19H21FO3/c1-3-4-5-12-22-18-11-8-15(13-17(18)20)19(21)23-16-9-6-14(2)7-10-16/h6-11,13H,3-5,12H2,1-2H3 |
| InChIKey | YOEJMDSUGZFQRW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|