C32H39FO4 — CID 19846982
[4-(4-octoxyphenyl)phenyl] 3-fluoro-4-pentoxybenzoate (PubChem CID 19846982) has the molecular formula C32H39FO4 and a molecular weight of 506.66 g/mol. Its IUPAC name is [4-(4-octoxyphenyl)phenyl] 3-fluoro-4-pentoxybenzoate.
| Compound Name | [4-(4-octoxyphenyl)phenyl] 3-fluoro-4-pentoxybenzoate |
|---|---|
| PubChem CID | 19846982 |
| Molecular Formula | C32H39FO4 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | [4-(4-octoxyphenyl)phenyl] 3-fluoro-4-pentoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(OCCCCC)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C32H39FO4/c1-3-5-7-8-9-11-22-35-28-17-12-25(13-18-28)26-14-19-29(20-15-26)37-32(34)27-16-21-31(30(33)24-27)36-23-10-6-4-2/h12-21,24H,3-11,22-23H2,1-2H3 |
| InChIKey | NHNLKLGFBWJJOI-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|