C23H29FO4 — CID 54114159
(3-fluoro-4-octoxyphenyl) 4-ethoxybenzoate (PubChem CID 54114159) has the molecular formula C23H29FO4 and a molecular weight of 388.48 g/mol. Its IUPAC name is (3-fluoro-4-octoxyphenyl) 4-ethoxybenzoate.
| Compound Name | (3-fluoro-4-octoxyphenyl) 4-ethoxybenzoate |
|---|---|
| PubChem CID | 54114159 |
| Molecular Formula | C23H29FO4 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (3-fluoro-4-octoxyphenyl) 4-ethoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(OC(=O)c2ccc(OCC)cc2)cc1F |
| InChI | InChI=1S/C23H29FO4/c1-3-5-6-7-8-9-16-27-22-15-14-20(17-21(22)24)28-23(25)18-10-12-19(13-11-18)26-4-2/h10-15,17H,3-9,16H2,1-2H3 |
| InChIKey | NJECULLWSHLEFI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|