(2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate

C26H34F2O4 — CID 19103799

IUPAC(2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate
SMILESCCCCCCCOc1ccc(OC(=O)c2ccc(OCCCCCC)cc2)c(F)c1F
InChIInChI=1S/C26H34F2O4/c1-3-5-7-9-11-19-31-22-16-17-23(25(28)24(22)27)32-26(29)20-12-14-21(15-13-20)30-18-10-8-6-4-2/h12-17H,3-11,18-19H2,1-2H3
InChIKeyWVIRQPKGLKCNPM-UHFFFAOYSA-N
MW448.55 g/mol
LogP7.49
Rot. Bonds15

About (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate

(2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate (PubChem CID 19103799) has the molecular formula C26H34F2O4 and a molecular weight of 448.55 g/mol. Its IUPAC name is (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate.

Molecular Properties

Compound Name(2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate
PubChem CID19103799
Molecular FormulaC26H34F2O4
Molecular Weight448.55 g/mol
Exact Mass448.24
IUPAC Name(2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate
SMILESCCCCCCCOc1ccc(OC(=O)c2ccc(OCCCCCC)cc2)c(F)c1F
InChIInChI=1S/C26H34F2O4/c1-3-5-7-9-11-19-31-22-16-17-23(25(28)24(22)27)32-26(29)20-12-14-21(15-13-20)30-18-10-8-6-4-2/h12-17H,3-11,18-19H2,1-2H3
InChIKeyWVIRQPKGLKCNPM-UHFFFAOYSA-N
XLogP7.49
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds15
Heavy Atoms32
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500448.55
LogP ≤ 57.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate?
The IUPAC name of (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate (CID 19103799) is (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate.
What is the SMILES notation for (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate?
The canonical SMILES for (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate is CCCCCCCOc1ccc(OC(=O)c2ccc(OCCCCCC)cc2)c(F)c1F.
What is the InChIKey of (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate?
The InChIKey is WVIRQPKGLKCNPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34F2O4/c1-3-5-7-9-11-19-31-22-16-17-23(25(28)24(22)27)32-26(29)20-12-14-21(15-13-20)30-18-10-8-6-4-2/h12-17H,3-11,18-19H2,1-2H3.
What are the key properties of (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate?
(2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate has a molecular weight of 448.55 g/mol, XLogP of 7.49, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate is sourced from PubChem (CID 19103799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).