C26H34F2O4 — CID 19103799
(2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate (PubChem CID 19103799) has the molecular formula C26H34F2O4 and a molecular weight of 448.55 g/mol. Its IUPAC name is (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate.
| Compound Name | (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate |
|---|---|
| PubChem CID | 19103799 |
| Molecular Formula | C26H34F2O4 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (2,3-difluoro-4-heptoxyphenyl) 4-hexoxybenzoate |
| SMILES | CCCCCCCOc1ccc(OC(=O)c2ccc(OCCCCCC)cc2)c(F)c1F |
| InChI | InChI=1S/C26H34F2O4/c1-3-5-7-9-11-19-31-22-16-17-23(25(28)24(22)27)32-26(29)20-12-14-21(15-13-20)30-18-10-8-6-4-2/h12-17H,3-11,18-19H2,1-2H3 |
| InChIKey | WVIRQPKGLKCNPM-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|