C34H42F2O4 — CID 14495670
(2,3-difluoro-4-heptoxyphenyl) 4-(4-octoxyphenyl)benzoate (PubChem CID 14495670) has the molecular formula C34H42F2O4 and a molecular weight of 552.70 g/mol. Its IUPAC name is (2,3-difluoro-4-heptoxyphenyl) 4-(4-octoxyphenyl)benzoate.
| Compound Name | (2,3-difluoro-4-heptoxyphenyl) 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 14495670 |
| Molecular Formula | C34H42F2O4 |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | (2,3-difluoro-4-heptoxyphenyl) 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(OCCCCCCC)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C34H42F2O4/c1-3-5-7-9-11-12-24-38-29-20-18-27(19-21-29)26-14-16-28(17-15-26)34(37)40-31-23-22-30(32(35)33(31)36)39-25-13-10-8-6-4-2/h14-23H,3-13,24-25H2,1-2H3 |
| InChIKey | OFBLURMZRSVZOA-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|