C28H27F2NO3 — CID 23051967
(4-cyano-2,3-difluorophenyl) 4-(4-octoxyphenyl)benzoate (PubChem CID 23051967) has the molecular formula C28H27F2NO3 and a molecular weight of 463.52 g/mol. Its IUPAC name is (4-cyano-2,3-difluorophenyl) 4-(4-octoxyphenyl)benzoate.
| Compound Name | (4-cyano-2,3-difluorophenyl) 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 23051967 |
| Molecular Formula | C28H27F2NO3 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (4-cyano-2,3-difluorophenyl) 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C#N)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C28H27F2NO3/c1-2-3-4-5-6-7-18-33-24-15-12-21(13-16-24)20-8-10-22(11-9-20)28(32)34-25-17-14-23(19-31)26(29)27(25)30/h8-17H,2-7,18H2,1H3 |
| InChIKey | UXSJMTCLEVFINT-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|