About [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate
[4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate (PubChem CID 86118969) has the molecular formula C28H29NO3
and a molecular weight of 427.54 g/mol. Its IUPAC name is [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate.
Molecular Properties
| Compound Name | [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate |
| PubChem CID | 86118969 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H29NO3/c1-2-3-4-5-6-7-20-31-26-16-12-23(13-17-26)24-14-18-27(19-15-24)32-28(30)25-10-8-22(21-29)9-11-25/h8-19H,2-7,20H2,1H3 |
| InChIKey | MGWKBXPDJNNYOM-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate?
The IUPAC name of [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate (CID 86118969) is [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate.
What is the SMILES notation for [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate?
The canonical SMILES for [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate is CCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(C#N)cc3)cc2)cc1.
What is the InChIKey of [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate?
The InChIKey is MGWKBXPDJNNYOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29NO3/c1-2-3-4-5-6-7-20-31-26-16-12-23(13-17-26)24-14-18-27(19-15-24)32-28(30)25-10-8-22(21-29)9-11-25/h8-19H,2-7,20H2,1H3.
What are the key properties of [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate?
[4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate has a molecular weight of 427.54 g/mol, XLogP of 7.18, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-octoxyphenyl)phenyl] 4-cyanobenzoate is sourced from PubChem (CID 86118969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).