About (4-heptoxyphenyl) 4-heptoxybenzoate
(4-heptoxyphenyl) 4-heptoxybenzoate (PubChem CID 71365288) has the molecular formula C27H38O4
and a molecular weight of 426.60 g/mol. Its IUPAC name is (4-heptoxyphenyl) 4-heptoxybenzoate.
Molecular Properties
| Compound Name | (4-heptoxyphenyl) 4-heptoxybenzoate |
| PubChem CID | 71365288 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | (4-heptoxyphenyl) 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(OC(=O)c2ccc(OCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C27H38O4/c1-3-5-7-9-11-21-29-24-15-13-23(14-16-24)27(28)31-26-19-17-25(18-20-26)30-22-12-10-8-6-4-2/h13-20H,3-12,21-22H2,1-2H3 |
| InChIKey | TXVKGDFCALVILQ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-heptoxyphenyl) 4-heptoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-heptoxyphenyl) 4-heptoxybenzoate?
The IUPAC name of (4-heptoxyphenyl) 4-heptoxybenzoate (CID 71365288) is (4-heptoxyphenyl) 4-heptoxybenzoate.
What is the SMILES notation for (4-heptoxyphenyl) 4-heptoxybenzoate?
The canonical SMILES for (4-heptoxyphenyl) 4-heptoxybenzoate is CCCCCCCOc1ccc(OC(=O)c2ccc(OCCCCCCC)cc2)cc1.
What is the InChIKey of (4-heptoxyphenyl) 4-heptoxybenzoate?
The InChIKey is TXVKGDFCALVILQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H38O4/c1-3-5-7-9-11-21-29-24-15-13-23(14-16-24)27(28)31-26-19-17-25(18-20-26)30-22-12-10-8-6-4-2/h13-20H,3-12,21-22H2,1-2H3.
What are the key properties of (4-heptoxyphenyl) 4-heptoxybenzoate?
(4-heptoxyphenyl) 4-heptoxybenzoate has a molecular weight of 426.60 g/mol, XLogP of 7.60, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-heptoxyphenyl) 4-heptoxybenzoate is sourced from PubChem (CID 71365288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).