About (4-hexoxyphenyl) 4-nonoxybenzoate
(4-hexoxyphenyl) 4-nonoxybenzoate (PubChem CID 14993431) has the molecular formula C28H40O4
and a molecular weight of 440.62 g/mol. Its IUPAC name is (4-hexoxyphenyl) 4-nonoxybenzoate.
Molecular Properties
| Compound Name | (4-hexoxyphenyl) 4-nonoxybenzoate |
| PubChem CID | 14993431 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | (4-hexoxyphenyl) 4-nonoxybenzoate |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C28H40O4/c1-3-5-7-9-10-11-13-23-30-25-16-14-24(15-17-25)28(29)32-27-20-18-26(19-21-27)31-22-12-8-6-4-2/h14-21H,3-13,22-23H2,1-2H3 |
| InChIKey | LSIHMDFOFJFJPL-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-hexoxyphenyl) 4-nonoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hexoxyphenyl) 4-nonoxybenzoate?
The IUPAC name of (4-hexoxyphenyl) 4-nonoxybenzoate (CID 14993431) is (4-hexoxyphenyl) 4-nonoxybenzoate.
What is the SMILES notation for (4-hexoxyphenyl) 4-nonoxybenzoate?
The canonical SMILES for (4-hexoxyphenyl) 4-nonoxybenzoate is CCCCCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCCC)cc2)cc1.
What is the InChIKey of (4-hexoxyphenyl) 4-nonoxybenzoate?
The InChIKey is LSIHMDFOFJFJPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H40O4/c1-3-5-7-9-10-11-13-23-30-25-16-14-24(15-17-25)28(29)32-27-20-18-26(19-21-27)31-22-12-8-6-4-2/h14-21H,3-13,22-23H2,1-2H3.
What are the key properties of (4-hexoxyphenyl) 4-nonoxybenzoate?
(4-hexoxyphenyl) 4-nonoxybenzoate has a molecular weight of 440.62 g/mol, XLogP of 7.99, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hexoxyphenyl) 4-nonoxybenzoate is sourced from PubChem (CID 14993431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).