C32H37NO4 — CID 102384256
[4-(4-cyanophenyl)phenyl] 3,4-dihexoxybenzoate (PubChem CID 102384256) has the molecular formula C32H37NO4 and a molecular weight of 499.65 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 3,4-dihexoxybenzoate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 3,4-dihexoxybenzoate |
|---|---|
| PubChem CID | 102384256 |
| Molecular Formula | C32H37NO4 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 3,4-dihexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)cc1OCCCCCC |
| InChI | InChI=1S/C32H37NO4/c1-3-5-7-9-21-35-30-20-17-28(23-31(30)36-22-10-8-6-4-2)32(34)37-29-18-15-27(16-19-29)26-13-11-25(24-33)12-14-26/h11-20,23H,3-10,21-22H2,1-2H3 |
| InChIKey | SROWYOPUYSLWML-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|