C74H102O12 — CID 102070228
bis[4-(3,4-didecoxybenzoyl)oxyphenyl] benzene-1,4-dicarboxylate (PubChem CID 102070228) has the molecular formula C74H102O12 and a molecular weight of 1183.62 g/mol. Its IUPAC name is bis[4-(3,4-didecoxybenzoyl)oxyphenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[4-(3,4-didecoxybenzoyl)oxyphenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 102070228 |
| Molecular Formula | C74H102O12 |
| Molecular Weight | 1183.62 g/mol |
| Exact Mass | 1182.74 |
| IUPAC Name | bis[4-(3,4-didecoxybenzoyl)oxyphenyl] benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(C(=O)Oc4ccc(OC(=O)c5ccc(OCCCCCCCCCC)c(OCCCCCCCCCC)c5)cc4)cc3)cc2)cc1OCCCCCCCCCC |
| InChI | InChI=1S/C74H102O12/c1-5-9-13-17-21-25-29-33-53-79-67-51-41-61(57-69(67)81-55-35-31-27-23-19-15-11-7-3)73(77)85-65-47-43-63(44-48-65)83-71(75)59-37-39-60(40-38-59)72(76)84-64-45-49-66(50-46-64)86-74(78)62-42-52-68(80-54-34-30-26-22-18-14-10-6-2)70(58-62)82-56-36-32-28-24-20-16-12-8-4/h37-52,57-58H,5-36,53-56H2,1-4H3 |
| InChIKey | BCESLPWRYXLOIF-UHFFFAOYSA-N |
| XLogP | 20.64 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1183.62 |
| LogP ≤ 5 | 20.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|