C66H82N2O8S — CID 101215506
[4-[2-[3,4-dicyano-5-[4-(3,4-dioctoxybenzoyl)oxyphenyl]thiophen-2-yl]ethynyl]phenyl] 3,4-dioctoxybenzoate (PubChem CID 101215506) has the molecular formula C66H82N2O8S and a molecular weight of 1063.45 g/mol. Its IUPAC name is [4-[2-[3,4-dicyano-5-[4-(3,4-dioctoxybenzoyl)oxyphenyl]thiophen-2-yl]ethynyl]phenyl] 3,4-dioctoxybenzoate.
| Compound Name | [4-[2-[3,4-dicyano-5-[4-(3,4-dioctoxybenzoyl)oxyphenyl]thiophen-2-yl]ethynyl]phenyl] 3,4-dioctoxybenzoate |
|---|---|
| PubChem CID | 101215506 |
| Molecular Formula | C66H82N2O8S |
| Molecular Weight | 1063.45 g/mol |
| Exact Mass | 1062.58 |
| IUPAC Name | [4-[2-[3,4-dicyano-5-[4-(3,4-dioctoxybenzoyl)oxyphenyl]thiophen-2-yl]ethynyl]phenyl] 3,4-dioctoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(C#Cc3sc(-c4ccc(OC(=O)c5ccc(OCCCCCCCC)c(OCCCCCCCC)c5)cc4)c(C#N)c3C#N)cc2)cc1OCCCCCCCC |
| InChI | InChI=1S/C66H82N2O8S/c1-5-9-13-17-21-25-43-71-59-40-34-53(47-61(59)73-45-27-23-19-15-11-7-3)65(69)75-55-36-29-51(30-37-55)31-42-63-57(49-67)58(50-68)64(77-63)52-32-38-56(39-33-52)76-66(70)54-35-41-60(72-44-26-22-18-14-10-6-2)62(48-54)74-46-28-24-20-16-12-8-4/h29-30,32-41,47-48H,5-28,43-46H2,1-4H3 |
| InChIKey | OELCAGLDQYTREL-UHFFFAOYSA-N |
| XLogP | 17.95 |
| TPSA | 137.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.45 |
| LogP ≤ 5 | 17.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|