(2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate

C25H28N2O4 — CID 3381345

IUPAC(2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate
SMILESCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCC)c(C#N)c2C#N)cc1
InChIInChI=1S/C25H28N2O4/c1-3-5-7-15-29-20-11-9-19(10-12-20)25(28)31-24-14-13-23(30-16-8-6-4-2)21(17-26)22(24)18-27/h9-14H,3-8,15-16H2,1-2H3
InChIKeyNQOTXYNZSMFULC-UHFFFAOYSA-N
MW420.51 g/mol
LogP5.79
Rot. Bonds12

About (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate

(2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate (PubChem CID 3381345) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate.

Molecular Properties

Compound Name(2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate
PubChem CID3381345
Molecular FormulaC25H28N2O4
Molecular Weight420.51 g/mol
Exact Mass420.20
IUPAC Name(2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate
SMILESCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCC)c(C#N)c2C#N)cc1
InChIInChI=1S/C25H28N2O4/c1-3-5-7-15-29-20-11-9-19(10-12-20)25(28)31-24-14-13-23(30-16-8-6-4-2)21(17-26)22(24)18-27/h9-14H,3-8,15-16H2,1-2H3
InChIKeyNQOTXYNZSMFULC-UHFFFAOYSA-N
XLogP5.79
TPSA92.34 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds12
Heavy Atoms31
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500420.51
LogP ≤ 55.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate?
The IUPAC name of (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate (CID 3381345) is (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate.
What is the SMILES notation for (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate?
The canonical SMILES for (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate is CCCCCOc1ccc(C(=O)Oc2ccc(OCCCCC)c(C#N)c2C#N)cc1.
What is the InChIKey of (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate?
The InChIKey is NQOTXYNZSMFULC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N2O4/c1-3-5-7-15-29-20-11-9-19(10-12-20)25(28)31-24-14-13-23(30-16-8-6-4-2)21(17-26)22(24)18-27/h9-14H,3-8,15-16H2,1-2H3.
What are the key properties of (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate?
(2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate has a molecular weight of 420.51 g/mol, XLogP of 5.79, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate is sourced from PubChem (CID 3381345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).