C25H28N2O4 — CID 3381345
(2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate (PubChem CID 3381345) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate.
| Compound Name | (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate |
|---|---|
| PubChem CID | 3381345 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (2,3-dicyano-4-pentoxyphenyl) 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(OCCCCC)c(C#N)c2C#N)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-3-5-7-15-29-20-11-9-19(10-12-20)25(28)31-24-14-13-23(30-16-8-6-4-2)21(17-26)22(24)18-27/h9-14H,3-8,15-16H2,1-2H3 |
| InChIKey | NQOTXYNZSMFULC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 92.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|