C36H44N4O3 — CID 54220410
(2,3-dicyano-4-nonoxyphenyl) 4-(5-octylpyrimidin-2-yl)benzoate (PubChem CID 54220410) has the molecular formula C36H44N4O3 and a molecular weight of 580.77 g/mol. Its IUPAC name is (2,3-dicyano-4-nonoxyphenyl) 4-(5-octylpyrimidin-2-yl)benzoate.
| Compound Name | (2,3-dicyano-4-nonoxyphenyl) 4-(5-octylpyrimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 54220410 |
| Molecular Formula | C36H44N4O3 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | (2,3-dicyano-4-nonoxyphenyl) 4-(5-octylpyrimidin-2-yl)benzoate |
| SMILES | CCCCCCCCCOc1ccc(OC(=O)c2ccc(-c3ncc(CCCCCCCC)cn3)cc2)c(C#N)c1C#N |
| InChI | InChI=1S/C36H44N4O3/c1-3-5-7-9-11-13-15-23-42-33-21-22-34(32(25-38)31(33)24-37)43-36(41)30-19-17-29(18-20-30)35-39-26-28(27-40-35)16-14-12-10-8-6-4-2/h17-22,26-27H,3-16,23H2,1-2H3 |
| InChIKey | QCEJQMVVATYNNP-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 108.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|