C30H34N2O6 — CID 20721762
7-[4-(2,3-dicyano-4-pentoxyphenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate (PubChem CID 20721762) has the molecular formula C30H34N2O6 and a molecular weight of 518.61 g/mol. Its IUPAC name is 7-[4-(2,3-dicyano-4-pentoxyphenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate.
| Compound Name | 7-[4-(2,3-dicyano-4-pentoxyphenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate |
|---|---|
| PubChem CID | 20721762 |
| Molecular Formula | C30H34N2O6 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 7-[4-(2,3-dicyano-4-pentoxyphenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate |
| SMILES | CCCCCOc1ccc(OC(=O)c2ccc(CCCCCCCOC(=O)C3CO3)cc2)c(C#N)c1C#N |
| InChI | InChI=1S/C30H34N2O6/c1-2-3-8-17-35-26-15-16-27(25(20-32)24(26)19-31)38-29(33)23-13-11-22(12-14-23)10-7-5-4-6-9-18-36-30(34)28-21-37-28/h11-16,28H,2-10,17-18,21H2,1H3 |
| InChIKey | BUCFZHWTNAJJPF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 121.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|