C23H16N2O9 — CID 22976487
[4-[2,3-dicyano-4-(oxirane-2-carbonyloxymethoxy)phenoxy]carbonylphenyl]methyl oxirane-2-carboxylate (PubChem CID 22976487) has the molecular formula C23H16N2O9 and a molecular weight of 464.39 g/mol. Its IUPAC name is [4-[2,3-dicyano-4-(oxirane-2-carbonyloxymethoxy)phenoxy]carbonylphenyl]methyl oxirane-2-carboxylate.
| Compound Name | [4-[2,3-dicyano-4-(oxirane-2-carbonyloxymethoxy)phenoxy]carbonylphenyl]methyl oxirane-2-carboxylate |
|---|---|
| PubChem CID | 22976487 |
| Molecular Formula | C23H16N2O9 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | [4-[2,3-dicyano-4-(oxirane-2-carbonyloxymethoxy)phenoxy]carbonylphenyl]methyl oxirane-2-carboxylate |
| SMILES | N#Cc1c(OCOC(=O)C2CO2)ccc(OC(=O)c2ccc(COC(=O)C3CO3)cc2)c1C#N |
| InChI | InChI=1S/C23H16N2O9/c24-7-15-16(8-25)18(6-5-17(15)32-12-33-23(28)20-11-30-20)34-21(26)14-3-1-13(2-4-14)9-31-22(27)19-10-29-19/h1-6,19-20H,9-12H2 |
| InChIKey | YXEKDXNCXRXZGD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 160.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|