About [4-(aminomethyl)phenyl] oxirane-2-carboxylate
[4-(aminomethyl)phenyl] oxirane-2-carboxylate (PubChem CID 174870874) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl] oxirane-2-carboxylate.
Molecular Properties
| Compound Name | [4-(aminomethyl)phenyl] oxirane-2-carboxylate |
| PubChem CID | 174870874 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | [4-(aminomethyl)phenyl] oxirane-2-carboxylate |
| SMILES | NCc1ccc(OC(=O)C2CO2)cc1 |
| InChI | InChI=1S/C10H11NO3/c11-5-7-1-3-8(4-2-7)14-10(12)9-6-13-9/h1-4,9H,5-6,11H2 |
| InChIKey | SCIOIXGULLUERJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [4-(aminomethyl)phenyl] oxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)phenyl] oxirane-2-carboxylate?
The IUPAC name of [4-(aminomethyl)phenyl] oxirane-2-carboxylate (CID 174870874) is [4-(aminomethyl)phenyl] oxirane-2-carboxylate.
What is the SMILES notation for [4-(aminomethyl)phenyl] oxirane-2-carboxylate?
The canonical SMILES for [4-(aminomethyl)phenyl] oxirane-2-carboxylate is NCc1ccc(OC(=O)C2CO2)cc1.
What is the InChIKey of [4-(aminomethyl)phenyl] oxirane-2-carboxylate?
The InChIKey is SCIOIXGULLUERJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c11-5-7-1-3-8(4-2-7)14-10(12)9-6-13-9/h1-4,9H,5-6,11H2.
What are the key properties of [4-(aminomethyl)phenyl] oxirane-2-carboxylate?
[4-(aminomethyl)phenyl] oxirane-2-carboxylate has a molecular weight of 193.20 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)phenyl] oxirane-2-carboxylate is sourced from PubChem (CID 174870874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).