About [4-(aminomethyl)phenyl] 2-acetyloxypropanoate
[4-(aminomethyl)phenyl] 2-acetyloxypropanoate (PubChem CID 91155705) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl] 2-acetyloxypropanoate.
Molecular Properties
| Compound Name | [4-(aminomethyl)phenyl] 2-acetyloxypropanoate |
| PubChem CID | 91155705 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | [4-(aminomethyl)phenyl] 2-acetyloxypropanoate |
| SMILES | CC(=O)OC(C)C(=O)Oc1ccc(CN)cc1 |
| InChI | InChI=1S/C12H15NO4/c1-8(16-9(2)14)12(15)17-11-5-3-10(7-13)4-6-11/h3-6,8H,7,13H2,1-2H3 |
| InChIKey | QTXJLTFFMARPDO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(aminomethyl)phenyl] 2-acetyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)phenyl] 2-acetyloxypropanoate?
The IUPAC name of [4-(aminomethyl)phenyl] 2-acetyloxypropanoate (CID 91155705) is [4-(aminomethyl)phenyl] 2-acetyloxypropanoate.
What is the SMILES notation for [4-(aminomethyl)phenyl] 2-acetyloxypropanoate?
The canonical SMILES for [4-(aminomethyl)phenyl] 2-acetyloxypropanoate is CC(=O)OC(C)C(=O)Oc1ccc(CN)cc1.
What is the InChIKey of [4-(aminomethyl)phenyl] 2-acetyloxypropanoate?
The InChIKey is QTXJLTFFMARPDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-8(16-9(2)14)12(15)17-11-5-3-10(7-13)4-6-11/h3-6,8H,7,13H2,1-2H3.
What are the key properties of [4-(aminomethyl)phenyl] 2-acetyloxypropanoate?
[4-(aminomethyl)phenyl] 2-acetyloxypropanoate has a molecular weight of 237.25 g/mol, XLogP of 1.00, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)phenyl] 2-acetyloxypropanoate is sourced from PubChem (CID 91155705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).