About [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate
[3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate (PubChem CID 176986856) has the molecular formula C15H12O9
and a molecular weight of 336.25 g/mol. Its IUPAC name is [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate.
Molecular Properties
| Compound Name | [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate |
| PubChem CID | 176986856 |
| Molecular Formula | C15H12O9 |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate |
| SMILES | O=C(Oc1cc(OC(=O)C2CO2)cc(OC(=O)[C@H]2CO2)c1)C1CO1 |
| InChI | InChI=1S/C15H12O9/c16-13(10-4-19-10)22-7-1-8(23-14(17)11-5-20-11)3-9(2-7)24-15(18)12-6-21-12/h1-3,10-12H,4-6H2/t10-,11?,12?/m1/s1 |
| InChIKey | SILPQADZOZUBBL-VOMCLLRMSA-N |
| XLogP | -0.40 |
| TPSA | 116.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate?
The IUPAC name of [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate (CID 176986856) is [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate.
What is the SMILES notation for [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate?
The canonical SMILES for [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate is O=C(Oc1cc(OC(=O)C2CO2)cc(OC(=O)[C@H]2CO2)c1)C1CO1.
What is the InChIKey of [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate?
The InChIKey is SILPQADZOZUBBL-VOMCLLRMSA-N. The full InChI is InChI=1S/C15H12O9/c16-13(10-4-19-10)22-7-1-8(23-14(17)11-5-20-11)3-9(2-7)24-15(18)12-6-21-12/h1-3,10-12H,4-6H2/t10-,11?,12?/m1/s1.
What are the key properties of [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate?
[3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate has a molecular weight of 336.25 g/mol, XLogP of -0.40, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(oxirane-2-carbonyloxy)-5-[(2R)-oxirane-2-carbonyl]oxyphenyl] oxirane-2-carboxylate is sourced from PubChem (CID 176986856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).