About (2-ethylphenyl) oxirane-2-carboxylate
(2-ethylphenyl) oxirane-2-carboxylate (PubChem CID 56974765) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is (2-ethylphenyl) oxirane-2-carboxylate.
Molecular Properties
| Compound Name | (2-ethylphenyl) oxirane-2-carboxylate |
| PubChem CID | 56974765 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (2-ethylphenyl) oxirane-2-carboxylate |
| SMILES | CCc1ccccc1OC(=O)C1CO1 |
| InChI | InChI=1S/C11H12O3/c1-2-8-5-3-4-6-9(8)14-11(12)10-7-13-10/h3-6,10H,2,7H2,1H3 |
| InChIKey | JSTQIWJOGGVGQY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2-ethylphenyl) oxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylphenyl) oxirane-2-carboxylate?
The IUPAC name of (2-ethylphenyl) oxirane-2-carboxylate (CID 56974765) is (2-ethylphenyl) oxirane-2-carboxylate.
What is the SMILES notation for (2-ethylphenyl) oxirane-2-carboxylate?
The canonical SMILES for (2-ethylphenyl) oxirane-2-carboxylate is CCc1ccccc1OC(=O)C1CO1.
What is the InChIKey of (2-ethylphenyl) oxirane-2-carboxylate?
The InChIKey is JSTQIWJOGGVGQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-2-8-5-3-4-6-9(8)14-11(12)10-7-13-10/h3-6,10H,2,7H2,1H3.
What are the key properties of (2-ethylphenyl) oxirane-2-carboxylate?
(2-ethylphenyl) oxirane-2-carboxylate has a molecular weight of 192.21 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylphenyl) oxirane-2-carboxylate is sourced from PubChem (CID 56974765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).