C22H18O3 — CID 36664572
(2-benzylphenyl) (2R)-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 36664572) has the molecular formula C22H18O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is (2-benzylphenyl) (2R)-2,3-dihydro-1-benzofuran-2-carboxylate.
| Compound Name | (2-benzylphenyl) (2R)-2,3-dihydro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 36664572 |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2-benzylphenyl) (2R)-2,3-dihydro-1-benzofuran-2-carboxylate |
| SMILES | O=C(Oc1ccccc1Cc1ccccc1)[C@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C22H18O3/c23-22(21-15-18-11-5-6-12-19(18)24-21)25-20-13-7-4-10-17(20)14-16-8-2-1-3-9-16/h1-13,21H,14-15H2/t21-/m1/s1 |
| InChIKey | OJXPDPZXRNIRJA-OAQYLSRUSA-N |
| XLogP | 4.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|