C10H9ClO2 — CID 45080935
2-chloro-1-(2,3-dihydro-1-benzofuran-2-yl)ethanone (PubChem CID 45080935) has the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. Its IUPAC name is 2-chloro-1-(2,3-dihydro-1-benzofuran-2-yl)ethanone.
| Compound Name | 2-chloro-1-(2,3-dihydro-1-benzofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 45080935 |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 2-chloro-1-(2,3-dihydro-1-benzofuran-2-yl)ethanone |
| SMILES | O=C(CCl)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C10H9ClO2/c11-6-8(12)10-5-7-3-1-2-4-9(7)13-10/h1-4,10H,5-6H2 |
| InChIKey | SIERJJOFHQYJIA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|