C16H20ClNO2 — CID 63391507
N-(2-chloroethyl)-N-cyclopentyl-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 63391507) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclopentyl-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-cyclopentyl-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 63391507 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclopentyl-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(C1Cc2ccccc2O1)N(CCCl)C1CCCC1 |
| InChI | InChI=1S/C16H20ClNO2/c17-9-10-18(13-6-2-3-7-13)16(19)15-11-12-5-1-4-8-14(12)20-15/h1,4-5,8,13,15H,2-3,6-7,9-11H2 |
| InChIKey | HNJDYTTUXOXEPS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|