C16H21NO2 — CID 9082273
(2R)-N-cycloheptyl-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 9082273) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (2R)-N-cycloheptyl-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2R)-N-cycloheptyl-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9082273 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (2R)-N-cycloheptyl-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC1CCCCCC1)[C@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C16H21NO2/c18-16(17-13-8-3-1-2-4-9-13)15-11-12-7-5-6-10-14(12)19-15/h5-7,10,13,15H,1-4,8-9,11H2,(H,17,18)/t15-/m1/s1 |
| InChIKey | LZDQLTKTSOCSPA-OAHLLOKOSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |