C16H21NO3 — CID 2176720
(3R)-N-cycloheptyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 2176720) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (3R)-N-cycloheptyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3R)-N-cycloheptyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 2176720 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (3R)-N-cycloheptyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(NC1CCCCCC1)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H21NO3/c18-16(17-12-7-3-1-2-4-8-12)15-11-19-13-9-5-6-10-14(13)20-15/h5-6,9-10,12,15H,1-4,7-8,11H2,(H,17,18)/t15-/m1/s1 |
| InChIKey | ABDJJTVTPKPHOA-OAHLLOKOSA-N |
| XLogP | 2.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |