C21H28N4O5 — CID 95784757
(3S)-N-cyclopentyl-3-[[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]carbamoyl]piperidine-1-carboxamide (PubChem CID 95784757) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is (3S)-N-cyclopentyl-3-[[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]carbamoyl]piperidine-1-carboxamide.
| Compound Name | (3S)-N-cyclopentyl-3-[[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]carbamoyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95784757 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (3S)-N-cyclopentyl-3-[[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]carbamoyl]piperidine-1-carboxamide |
| SMILES | O=C(NNC(=O)[C@H]1COc2ccccc2O1)[C@H]1CCCN(C(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C21H28N4O5/c26-19(14-6-5-11-25(12-14)21(28)22-15-7-1-2-8-15)23-24-20(27)18-13-29-16-9-3-4-10-17(16)30-18/h3-4,9-10,14-15,18H,1-2,5-8,11-13H2,(H,22,28)(H,23,26)(H,24,27)/t14-,18+/m0/s1 |
| InChIKey | QXLIJTZMQQUVTA-KBXCAEBGSA-N |
| XLogP | 1.34 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|