C10H9KN2O3S2 — CID 23710046
potassium N-(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)carbamodithioate (PubChem CID 23710046) has the molecular formula C10H9KN2O3S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is potassium N-(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)carbamodithioate.
| Compound Name | potassium N-(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)carbamodithioate |
|---|---|
| PubChem CID | 23710046 |
| Molecular Formula | C10H9KN2O3S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | potassium N-(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)carbamodithioate |
| SMILES | O=C(NNC(=S)[S-])C1COc2ccccc2O1.[K+] |
| InChI | InChI=1S/C10H10N2O3S2.K/c13-9(11-12-10(16)17)8-5-14-6-3-1-2-4-7(6)15-8;/h1-4,8H,5H2,(H,11,13)(H2,12,16,17);/q;+1/p-1 |
| InChIKey | NMOVMFCYYIGRAI-UHFFFAOYSA-M |
| XLogP | -2.72 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|