C10H11N3O4 — CID 60704410
(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)urea (PubChem CID 60704410) has the molecular formula C10H11N3O4 and a molecular weight of 237.22 g/mol. Its IUPAC name is (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)urea.
| Compound Name | (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)urea |
|---|---|
| PubChem CID | 60704410 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)urea |
| SMILES | NC(=O)NNC(=O)C1COc2ccccc2O1 |
| InChI | InChI=1S/C10H11N3O4/c11-10(15)13-12-9(14)8-5-16-6-3-1-2-4-7(6)17-8/h1-4,8H,5H2,(H,12,14)(H3,11,13,15) |
| InChIKey | NUPSDRLVUVFWIC-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|