C21H18N2O4 — CID 2426915
(3R)-N'-(2-naphthalen-1-ylacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 2426915) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is (3R)-N'-(2-naphthalen-1-ylacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | (3R)-N'-(2-naphthalen-1-ylacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 2426915 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (3R)-N'-(2-naphthalen-1-ylacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | O=C(Cc1cccc2ccccc12)NNC(=O)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C21H18N2O4/c24-20(12-15-8-5-7-14-6-1-2-9-16(14)15)22-23-21(25)19-13-26-17-10-3-4-11-18(17)27-19/h1-11,19H,12-13H2,(H,22,24)(H,23,25)/t19-/m1/s1 |
| InChIKey | BVXRELWMXLKTQS-LJQANCHMSA-N |
| XLogP | 2.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|