C19H18N2O7 — CID 8672108
[2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 2-(4-hydroxyphenyl)acetate (PubChem CID 8672108) has the molecular formula C19H18N2O7 and a molecular weight of 386.36 g/mol. Its IUPAC name is [2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 2-(4-hydroxyphenyl)acetate.
| Compound Name | [2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 8672108 |
| Molecular Formula | C19H18N2O7 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 2-(4-hydroxyphenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(O)cc1)NNC(=O)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C19H18N2O7/c22-13-7-5-12(6-8-13)9-18(24)27-11-17(23)20-21-19(25)16-10-26-14-3-1-2-4-15(14)28-16/h1-8,16,22H,9-11H2,(H,20,23)(H,21,25)/t16-/m0/s1 |
| InChIKey | ZICMGLWFZNVDKR-INIZCTEOSA-N |
| XLogP | 0.47 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|