C20H20N2O7 — CID 8792495
[2-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 2-(3-methoxyphenyl)acetate (PubChem CID 8792495) has the molecular formula C20H20N2O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is [2-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 2-(3-methoxyphenyl)acetate.
| Compound Name | [2-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 2-(3-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8792495 |
| Molecular Formula | C20H20N2O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [2-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 2-(3-methoxyphenyl)acetate |
| SMILES | COc1cccc(CC(=O)OCC(=O)NNC(=O)[C@H]2COc3ccccc3O2)c1 |
| InChI | InChI=1S/C20H20N2O7/c1-26-14-6-4-5-13(9-14)10-19(24)28-12-18(23)21-22-20(25)17-11-27-15-7-2-3-8-16(15)29-17/h2-9,17H,10-12H2,1H3,(H,21,23)(H,22,25)/t17-/m1/s1 |
| InChIKey | QLGMOHLBSKKEBS-QGZVFWFLSA-N |
| XLogP | 0.77 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|