C18H18N2O6S — CID 8655314
[2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 3-thiophen-3-ylpropanoate (PubChem CID 8655314) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is [2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 3-thiophen-3-ylpropanoate.
| Compound Name | [2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 8655314 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 3-thiophen-3-ylpropanoate |
| SMILES | O=C(COC(=O)CCc1ccsc1)NNC(=O)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C18H18N2O6S/c21-16(10-25-17(22)6-5-12-7-8-27-11-12)19-20-18(23)15-9-24-13-3-1-2-4-14(13)26-15/h1-4,7-8,11,15H,5-6,9-10H2,(H,19,21)(H,20,23)/t15-/m0/s1 |
| InChIKey | KLUQESFQHBCEFT-HNNXBMFYSA-N |
| XLogP | 1.21 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|