C16H13ClN2O6S — CID 7146375
[2-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate (PubChem CID 7146375) has the molecular formula C16H13ClN2O6S and a molecular weight of 396.81 g/mol. Its IUPAC name is [2-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate.
| Compound Name | [2-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7146375 |
| Molecular Formula | C16H13ClN2O6S |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | [2-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Cl)s1)NNC(=O)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H13ClN2O6S/c17-13-6-5-12(26-13)16(22)24-8-14(20)18-19-15(21)11-7-23-9-3-1-2-4-10(9)25-11/h1-6,11H,7-8H2,(H,18,20)(H,19,21)/t11-/m1/s1 |
| InChIKey | ABRKTGJMNTWUPF-LLVKDONJSA-N |
| XLogP | 1.55 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|