C16H14N2O6S — CID 8630903
[2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 8630903) has the molecular formula C16H14N2O6S and a molecular weight of 362.36 g/mol. Its IUPAC name is [2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 8630903 |
| Molecular Formula | C16H14N2O6S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | [2-[2-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cccs1)NNC(=O)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H14N2O6S/c19-14(9-23-16(21)13-6-3-7-25-13)17-18-15(20)12-8-22-10-4-1-2-5-11(10)24-12/h1-7,12H,8-9H2,(H,17,19)(H,18,20)/t12-/m0/s1 |
| InChIKey | LSDNVZUJOGWATC-LBPRGKRZSA-N |
| XLogP | 0.89 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|