C21H23N3O6S — CID 55648305
1-(benzenesulfonyl)-N'-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperidine-3-carbohydrazide (PubChem CID 55648305) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N'-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperidine-3-carbohydrazide.
| Compound Name | 1-(benzenesulfonyl)-N'-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 55648305 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 1-(benzenesulfonyl)-N'-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1COc2ccccc2O1)C1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H23N3O6S/c25-20(22-23-21(26)19-14-29-17-10-4-5-11-18(17)30-19)15-7-6-12-24(13-15)31(27,28)16-8-2-1-3-9-16/h1-5,8-11,15,19H,6-7,12-14H2,(H,22,25)(H,23,26) |
| InChIKey | VMSCMHNTPLNYHW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|