C19H28N2O3S — CID 39898448
(3S)-1-(benzenesulfonyl)-N-cycloheptylpiperidine-3-carboxamide (PubChem CID 39898448) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is (3S)-1-(benzenesulfonyl)-N-cycloheptylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-(benzenesulfonyl)-N-cycloheptylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 39898448 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (3S)-1-(benzenesulfonyl)-N-cycloheptylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCCC1)[C@H]1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C19H28N2O3S/c22-19(20-17-10-4-1-2-5-11-17)16-9-8-14-21(15-16)25(23,24)18-12-6-3-7-13-18/h3,6-7,12-13,16-17H,1-2,4-5,8-11,14-15H2,(H,20,22)/t16-/m0/s1 |
| InChIKey | NKADORUHYRKQGV-INIZCTEOSA-N |
| XLogP | 2.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |