C24H30N2O4S — CID 11619138
(3S)-N-cyclohexyl-1-(3-phenoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 11619138) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is (3S)-N-cyclohexyl-1-(3-phenoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-cyclohexyl-1-(3-phenoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 11619138 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (3S)-N-cyclohexyl-1-(3-phenoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@H]1CCCN(S(=O)(=O)c2cccc(Oc3ccccc3)c2)C1 |
| InChI | InChI=1S/C24H30N2O4S/c27-24(25-20-10-3-1-4-11-20)19-9-8-16-26(18-19)31(28,29)23-15-7-14-22(17-23)30-21-12-5-2-6-13-21/h2,5-7,12-15,17,19-20H,1,3-4,8-11,16,18H2,(H,25,27)/t19-/m0/s1 |
| InChIKey | IMFUYMFBXNVVDT-IBGZPJMESA-N |
| XLogP | 4.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |