C19H28N2O5S — CID 76823868
N-(3-hydroxycyclohexyl)-1-(3-methoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 76823868) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(3-hydroxycyclohexyl)-1-(3-methoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(3-hydroxycyclohexyl)-1-(3-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 76823868 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-(3-hydroxycyclohexyl)-1-(3-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | COc1cccc(S(=O)(=O)N2CCCC(C(=O)NC3CCCC(O)C3)C2)c1 |
| InChI | InChI=1S/C19H28N2O5S/c1-26-17-8-3-9-18(12-17)27(24,25)21-10-4-5-14(13-21)19(23)20-15-6-2-7-16(22)11-15/h3,8-9,12,14-16,22H,2,4-7,10-11,13H2,1H3,(H,20,23) |
| InChIKey | YMCKWOHJUAQSMB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |