C11H15NO4S — CID 81258608
(3R)-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-ol (PubChem CID 81258608) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is (3R)-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R)-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 81258608 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (3R)-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-ol |
| SMILES | COc1cccc(S(=O)(=O)N2CC[C@@H](O)C2)c1 |
| InChI | InChI=1S/C11H15NO4S/c1-16-10-3-2-4-11(7-10)17(14,15)12-6-5-9(13)8-12/h2-4,7,9,13H,5-6,8H2,1H3/t9-/m1/s1 |
| InChIKey | VCYGENGUUXVRQY-SECBINFHSA-N |
| XLogP | 0.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |