C15H17NO3S2 — CID 131703854
1-(3-methoxyphenyl)sulfonyl-3-thiophen-2-ylpyrrolidine (PubChem CID 131703854) has the molecular formula C15H17NO3S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)sulfonyl-3-thiophen-2-ylpyrrolidine.
| Compound Name | 1-(3-methoxyphenyl)sulfonyl-3-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 131703854 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-(3-methoxyphenyl)sulfonyl-3-thiophen-2-ylpyrrolidine |
| SMILES | COc1cccc(S(=O)(=O)N2CCC(c3cccs3)C2)c1 |
| InChI | InChI=1S/C15H17NO3S2/c1-19-13-4-2-5-14(10-13)21(17,18)16-8-7-12(11-16)15-6-3-9-20-15/h2-6,9-10,12H,7-8,11H2,1H3 |
| InChIKey | LOCLCLJKCWZJGM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |