C11H15NO3S — CID 66291650
(3R)-1-(3-methylphenyl)sulfonylpyrrolidin-3-ol (PubChem CID 66291650) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is (3R)-1-(3-methylphenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R)-1-(3-methylphenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 66291650 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | (3R)-1-(3-methylphenyl)sulfonylpyrrolidin-3-ol |
| SMILES | Cc1cccc(S(=O)(=O)N2CC[C@@H](O)C2)c1 |
| InChI | InChI=1S/C11H15NO3S/c1-9-3-2-4-11(7-9)16(14,15)12-6-5-10(13)8-12/h2-4,7,10,13H,5-6,8H2,1H3/t10-/m1/s1 |
| InChIKey | JHJHUFWMGOVCCF-SNVBAGLBSA-N |
| XLogP | 0.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |