C13H17NO4S — CID 47320003
methyl 1-(3-methylphenyl)sulfonylpyrrolidine-3-carboxylate (PubChem CID 47320003) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is methyl 1-(3-methylphenyl)sulfonylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(3-methylphenyl)sulfonylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 47320003 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | methyl 1-(3-methylphenyl)sulfonylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)c2cccc(C)c2)C1 |
| InChI | InChI=1S/C13H17NO4S/c1-10-4-3-5-12(8-10)19(16,17)14-7-6-11(9-14)13(15)18-2/h3-5,8,11H,6-7,9H2,1-2H3 |
| InChIKey | KZVKOESIWBLKND-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |